| MolName | 2-[(Z)-[[2-(5-amino-1,3,4-thiadiazol-2-yl)acetyl]hydrazinylidene]methyl]-4-nitrophenolate |
| MolecularFormula | C11H9N6O4S |
| Smiles | Nc1nnc(CC(N/N=C\c(cc(cc2)[N+]([O-])=O)c2[O-])=O)s1 |
| InChI | InChI=1S/C11H10N6O4S/c12-11-16-15-10(22-11)4-9(19)14-13-5-6-3-7(17(20)21)1-2-8(6)18/h1-3,5,18H,4H2,(H2,12,16)(H,14,19)/p-1 |
| InChIK | OCRDEAMLLVDZKT-UHFFFAOYSA-M |
| TotalMolweight | 321.296 |
| Molweight | 321.296 |
| MonoisotopicMass | 321.040599 |
| CLogP | -1.4799 |
| CLogS | -3.133 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 233.93 |
| Relative PSA | 0.59112 |
| PolarSurfaceArea | 190.38 |
| Druglikeness | 0.67413 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-[[2-(5-amino-1,3,4-thiadiazol-2-yl)acetyl]hydrazinylidene]methyl]-4-nitrophenolate | 2 - 2-[(Z)-[[2-(5-amino-1,3,4-thiadiazol-2-yl)acetyl]hydrazinylidene]methyl]-4-nitrophenolate