| MolName | 1-(2,4-dichlorophenyl)-3-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]thiourea |
| MolecularFormula | C12H8N4O2Cl2S2 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(Nc(ccc(Cl)c2)c2Cl)=S)s1)=O |
| InChI | InChI=1S/C12H8Cl2N4O2S2/c13-7-1-3-10(9(14)5-7)16-12(21)17-15-6-8-2-4-11(22-8)18(19)20/h1-6H,(H2,16,17,21) |
| InChIK | OCVPPRJMAXRWNW-UHFFFAOYSA-N |
| TotalMolweight | 375.26 |
| Molweight | 375.26 |
| MonoisotopicMass | 373.94657 |
| CLogP | 3.9388 |
| CLogS | -6.413 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 263.86 |
| Relative PSA | 0.42905 |
| PolarSurfaceArea | 142.57 |
| Druglikeness | -1.4222 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(2,4-dichlorophenyl)-3-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]thiourea | 2 - 1-(2,4-dichlorophenyl)-3-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]thiourea