| MolName | 1-[(E)-[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylideneamino]-3-phenylurea |
| MolecularFormula | C24H19N5OCl2 |
| Smiles | O=C(Nc1ccccc1)N/N=C/c1cn(Cc(ccc(Cl)c2)c2Cl)nc1-c1ccccc1 |
| InChI | InChI=1S/C24H19Cl2N5O/c25-20-12-11-18(22(26)13-20)15-31-16-19(23(30-31)17-7-3-1-4-8-17)14-27-29-24(32)28-21-9-5-2-6-10-21/h1-14,16H,15H2,(H2,28,29,32) |
| InChIK | OCXBMAKGLNJVIN-UHFFFAOYSA-N |
| TotalMolweight | 464.355 |
| Molweight | 464.355 |
| MonoisotopicMass | 463.096664 |
| CLogP | 5.5775 |
| CLogS | -7.044 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 350.53 |
| Relative PSA | 0.18632 |
| PolarSurfaceArea | 71.31 |
| Druglikeness | 5.9029 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(E)-[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylideneamino]-3-phenylurea | 2 - 1-[(E)-[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylideneamino]-3-phenylurea