| MolName | 5-[(2Z)-2-[(5-bromothiophen-2-yl)methylidene]hydrazinyl]-4-chloro-2-phenylpyridazin-3-one |
| MolecularFormula | C15H10N4OBrClS |
| Smiles | O=C1N(c2ccccc2)N=CC(N/N=C\c(s2)ccc2Br)=C1Cl |
| InChI | InChI=1S/C15H10BrClN4OS/c16-13-7-6-11(23-13)8-18-20-12-9-19-21(15(22)14(12)17)10-4-2-1-3-5-10/h1-9,20H |
| InChIK | OCZKLHZIPIVKRK-UHFFFAOYSA-N |
| TotalMolweight | 409.694 |
| Molweight | 409.694 |
| MonoisotopicMass | 407.944719 |
| CLogP | 4.3973 |
| CLogS | -5.446 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 261.46 |
| Relative PSA | 0.2732 |
| PolarSurfaceArea | 85.3 |
| Druglikeness | 1.2046 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; 2-halo-enone |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 5-[(2Z)-2-[(5-bromothiophen-2-yl)methylidene]hydrazinyl]-4-chloro-2-phenylpyridazin-3-one | 2 - 5-[(2Z)-2-[(5-bromothiophen-2-yl)methylidene]hydrazinyl]-4-chloro-2-phenylpyridazin-3-one