| MolName | 4-N-benzyl-2-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C22H22N7O3Br |
| Smiles | Brc1c(/C=N\Nc2nc(N3CCOCC3)nc(NCc3ccccc3)n2)cc2OCOc2c1 |
| InChI | InChI=1S/C22H22BrN7O3/c23-17-11-19-18(32-14-33-19)10-16(17)13-25-29-21-26-20(24-12-15-4-2-1-3-5-15)27-22(28-21)30-6-8-31-9-7-30/h1-5,10-11,13H,6-9,12,14H2,(H2,24,26,27,28,29) |
| InChIK | ODBWVOYCXCISMV-UHFFFAOYSA-N |
| TotalMolweight | 512.367 |
| Molweight | 512.367 |
| MonoisotopicMass | 511.096749 |
| CLogP | 5.8332 |
| CLogS | -6.366 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 351.23 |
| Relative PSA | 0.28725 |
| PolarSurfaceArea | 106.02 |
| Druglikeness | 1.6272 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 9 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-N-benzyl-2-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine | 2 - 4-N-benzyl-2-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine