| MolName | 3-benzyl-5-[(Z)-[(Z)-(3-benzyl-4-chloro-2-oxo-1,3-thiazol-5-yl)methylidenehydrazinylidene]methyl]-4-chloro-1,3-thiazol-2-one |
| MolecularFormula | C22H16N4O2Cl2S2 |
| Smiles | O=C(N1Cc2ccccc2)SC(/C=N\N=C/C(SC(N2Cc3ccccc3)=O)=C2Cl)=C1Cl |
| InChI | InChI=1S/C22H16Cl2N4O2S2/c23-19-17(31-21(29)27(19)13-15-7-3-1-4-8-15)11-25-26-12-18-20(24)28(22(30)32-18)14-16-9-5-2-6-10-16/h1-12H,13-14H2 |
| InChIK | ODEIWZRGMNURBP-UHFFFAOYSA-N |
| TotalMolweight | 503.433 |
| Molweight | 503.433 |
| MonoisotopicMass | 502.00917 |
| CLogP | 5.5262 |
| CLogS | -7.346 |
| H Acceptors | 6 |
| TotalSurfaceArea | 350.82 |
| Relative PSA | 0.25991 |
| PolarSurfaceArea | 115.94 |
| Druglikeness | 5.5223 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | polar activated DB; dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 18 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-benzyl-5-[(Z)-[(Z)-(3-benzyl-4-chloro-2-oxo-1,3-thiazol-5-yl)methylidenehydrazinylidene]methyl]-4-chloro-1,3-thiazol-2-one | 2 - 3-benzyl-5-[(Z)-[(Z)-(3-benzyl-4-chloro-2-oxo-1,3-thiazol-5-yl)methylidenehydrazinylidene]methyl]-4-chloro-1,3-thiazol-2-one