| MolName | N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-1,3-benzodioxole-5-carboxamide |
| MolecularFormula | C17H17N3O4S |
| Smiles | O=C(c(cc1)cc2c1OCO2)N/N=C\c1ccc(N2CCOCC2)s1 |
| InChI | InChI=1S/C17H17N3O4S/c21-17(12-1-3-14-15(9-12)24-11-23-14)19-18-10-13-2-4-16(25-13)20-5-7-22-8-6-20/h1-4,9-10H,5-8,11H2,(H,19,21) |
| InChIK | ODMVBGDVIZHMOM-UHFFFAOYSA-N |
| TotalMolweight | 359.405 |
| Molweight | 359.405 |
| MonoisotopicMass | 359.093977 |
| CLogP | 3.0382 |
| CLogS | -4.695 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 265.03 |
| Relative PSA | 0.33928 |
| PolarSurfaceArea | 100.63 |
| Druglikeness | 6.2506 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 8 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-1,3-benzodioxole-5-carboxamide | 2 - N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-1,3-benzodioxole-5-carboxamide