| MolName | [(Z)-[4-[(Z)-(carbamoylhydrazinylidene)methyl]phenyl]methylideneamino]urea |
| MolecularFormula | C10H12N6O2 |
| Smiles | NC(N/N=C\c1ccc(/C=N\NC(N)=O)cc1)=O |
| InChI | InChI=1S/C10H12N6O2/c11-9(17)15-13-5-7-1-2-8(4-3-7)6-14-16-10(12)18/h1-6H,(H3,11,15,17)(H3,12,16,18) |
| InChIK | ODNSMDXGASIMOX-UHFFFAOYSA-N |
| TotalMolweight | 248.245 |
| Molweight | 248.245 |
| MonoisotopicMass | 248.102174 |
| CLogP | 0.611 |
| CLogS | -4.012 |
| H Acceptors | 8 |
| H Donors | 4 |
| TotalSurfaceArea | 198.24 |
| Relative PSA | 0.51735 |
| PolarSurfaceArea | 134.96 |
| Druglikeness | 4.2967 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.77778 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Symmetricatoms | 10 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-[4-[(Z)-(carbamoylhydrazinylidene)methyl]phenyl]methylideneamino]urea | 2 - [(Z)-[4-[(Z)-(carbamoylhydrazinylidene)methyl]phenyl]methylideneamino]urea