| MolName | 4-[(2Z)-2-[[1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]methylidene]hydrazinyl]benzoic acid |
| MolecularFormula | C22H17N4O2Cl |
| Smiles | OC(c(cc1)ccc1N/N=C\c1nc(cccc2)c2n1Cc(cc1)ccc1Cl)=O |
| InChI | InChI=1S/C22H17ClN4O2/c23-17-9-5-15(6-10-17)14-27-20-4-2-1-3-19(20)25-21(27)13-24-26-18-11-7-16(8-12-18)22(28)29/h1-13,26H,14H2,(H,28,29) |
| InChIK | ODOKEKPNQQNHCP-UHFFFAOYSA-N |
| TotalMolweight | 404.856 |
| Molweight | 404.856 |
| MonoisotopicMass | 404.104003 |
| CLogP | 5.741 |
| CLogS | -3.846 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 304.84 |
| Relative PSA | 0.21962 |
| PolarSurfaceArea | 79.51 |
| Druglikeness | 3.9848 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.58621 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2Z)-2-[[1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]methylidene]hydrazinyl]benzoic acid | 2 - 4-[(2Z)-2-[[1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]methylidene]hydrazinyl]benzoic acid