| MolName | N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]-N-(furan-2-ylmethyl)oxamide |
| MolecularFormula | C14H11N3O3Cl2 |
| Smiles | O=C(C(N/N=C\c(ccc(Cl)c1)c1Cl)=O)NCc1ccco1 |
| InChI | InChI=1S/C14H11Cl2N3O3/c15-10-4-3-9(12(16)6-10)7-18-19-14(21)13(20)17-8-11-2-1-5-22-11/h1-7H,8H2,(H,17,20)(H,19,21) |
| InChIK | ODQYIYWTYHDRGM-UHFFFAOYSA-N |
| TotalMolweight | 340.165 |
| Molweight | 340.165 |
| MonoisotopicMass | 339.017746 |
| CLogP | 2.254 |
| CLogS | -4.495 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 250.49 |
| Relative PSA | 0.2979 |
| PolarSurfaceArea | 83.7 |
| Druglikeness | 3.9186 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]-N-(furan-2-ylmethyl)oxamide | 2 - N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]-N-(furan-2-ylmethyl)oxamide