4-[(Z)-(1,3-dioxoisoindol-2-yl)iminomethyl]benzoic acid
Formula:C16H10N2O4
Mutagenic:none
Tumorigenic:none
Reproductive Effective:none
4-[(Z)-(1,3-dioxoisoindol-2-yl)iminomethyl]benzoic acid is a drug-like molecule.
| MolName | 4-[(Z)-(1,3-dioxoisoindol-2-yl)iminomethyl]benzoic acid |
| MolecularFormula | C16H10N2O4 |
| Smiles | OC(c1ccc(/C=N\N(C(c2c3cccc2)=O)C3=O)cc1)=O |
| InChI | InChI=1S/C16H10N2O4/c19-14-12-3-1-2-4-13(12)15(20)18(14)17-9-10-5-7-11(8-6-10)16(21)22/h1-9H,(H,21,22) |
| InChIK | OEEWYAKOMNOIGJ-UHFFFAOYSA-N |
| TotalMolweight | 294.265 |
| Molweight | 294.265 |
| MonoisotopicMass | 294.064058 |
| CLogP | 2.1368 |
| CLogS | -3.595 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 214.18 |
| Relative PSA | 0.31413 |
| PolarSurfaceArea | 87.04 |
| Druglikeness | 3.5352 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 7 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(1,3-dioxoisoindol-2-yl)iminomethyl]benzoic acid | 2 - 4-[(Z)-(1,3-dioxoisoindol-2-yl)iminomethyl]benzoic acid
Spacefill |
Wire |
Ball & Stick |
Iso-vdw |
Opaque |
Dot Surface |
Mep |
Translucent |
Spin |
Label On |
Off