| MolName | N-[(Z)-anthracen-9-ylmethylideneamino]-2-[N-(benzenesulfonyl)-2-chloroanilino]acetamide |
| MolecularFormula | C29H22N3O3ClS |
| Smiles | O=C(CN(c(cccc1)c1Cl)S(c1ccccc1)(=O)=O)N/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C29H22ClN3O3S/c30-27-16-8-9-17-28(27)33(37(35,36)23-12-2-1-3-13-23)20-29(34)32-31-19-26-24-14-6-4-10-21(24)18-22-11-5-7-15-25(22)26/h1-19H,20H2,(H,32,34) |
| InChIK | OEFRSGSHRYQQOW-UHFFFAOYSA-N |
| TotalMolweight | 528.031 |
| Molweight | 528.031 |
| MonoisotopicMass | 527.107039 |
| CLogP | 6.0456 |
| CLogS | -8.874 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 384.01 |
| Relative PSA | 0.17744 |
| PolarSurfaceArea | 87.22 |
| Druglikeness | -2.5458 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.43243 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 2 |
| Symmetricatoms | 9 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-anthracen-9-ylmethylideneamino]-2-[N-(benzenesulfonyl)-2-chloroanilino]acetamide | 2 - N-[(Z)-anthracen-9-ylmethylideneamino]-2-[N-(benzenesulfonyl)-2-chloroanilino]acetamide