| MolName | (Z)-N-(3-benzylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)-1-(5-iodofuran-2-yl)methanimine |
| MolecularFormula | C19H14N5OIS |
| Smiles | Ic1ccc(/C=N\n2c(SCc3ccccc3)nnc2-c2ccncc2)o1 |
| InChI | InChI=1S/C19H14IN5OS/c20-17-7-6-16(26-17)12-22-25-18(15-8-10-21-11-9-15)23-24-19(25)27-13-14-4-2-1-3-5-14/h1-12H,13H2 |
| InChIK | OFESZNHDDZGSAM-UHFFFAOYSA-N |
| TotalMolweight | 487.32 |
| Molweight | 487.32 |
| MonoisotopicMass | 486.996378 |
| CLogP | 3.7971 |
| CLogS | -8.319 |
| H Acceptors | 6 |
| TotalSurfaceArea | 310 |
| Relative PSA | 0.26739 |
| PolarSurfaceArea | 94.4 |
| Druglikeness | 6.5709 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51852 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-(3-benzylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)-1-(5-iodofuran-2-yl)methanimine | 2 - (Z)-N-(3-benzylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)-1-(5-iodofuran-2-yl)methanimine