| MolName | 3-carbazol-9-yl-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]propanamide |
| MolecularFormula | C22H17N3OCl2 |
| Smiles | O=C(CCn1c(cccc2)c2c2c1cccc2)N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C22H17Cl2N3O/c23-16-10-9-15(19(24)13-16)14-25-26-22(28)11-12-27-20-7-3-1-5-17(20)18-6-2-4-8-21(18)27/h1-10,13-14H,11-12H2,(H,26,28) |
| InChIK | OFMDTSGGVBOZRT-UHFFFAOYSA-N |
| TotalMolweight | 410.303 |
| Molweight | 410.303 |
| MonoisotopicMass | 409.074866 |
| CLogP | 5.8517 |
| CLogS | -6.619 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 303.75 |
| Relative PSA | 0.14117 |
| PolarSurfaceArea | 46.39 |
| Druglikeness | 6.1009 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-carbazol-9-yl-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]propanamide | 2 - 3-carbazol-9-yl-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]propanamide