| MolName | [(Z)-(8-chloro-4H-thieno[3,2-c]chromen-2-yl)methylideneamino]thiourea |
| MolecularFormula | C13H10N3OClS2 |
| Smiles | NC(N/N=C\c1cc(COc(cc2)c-3cc2Cl)c3s1)=S |
| InChI | InChI=1S/C13H10ClN3OS2/c14-8-1-2-11-10(4-8)12-7(6-18-11)3-9(20-12)5-16-17-13(15)19/h1-5H,6H2,(H3,15,17,19) |
| InChIK | OFQPHOWRILATLT-UHFFFAOYSA-N |
| TotalMolweight | 323.827 |
| Molweight | 323.827 |
| MonoisotopicMass | 322.995379 |
| CLogP | 3.4032 |
| CLogS | -6.006 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 232.09 |
| Relative PSA | 0.41622 |
| PolarSurfaceArea | 119.97 |
| Druglikeness | 3.502 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 2 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-(8-chloro-4H-thieno[3,2-c]chromen-2-yl)methylideneamino]thiourea | 2 - [(Z)-(8-chloro-4H-thieno[3,2-c]chromen-2-yl)methylideneamino]thiourea