| MolName | 2,4,6-trichloro-N-[(Z)-(2-iodophenyl)methylideneamino]aniline |
| MolecularFormula | C13H8N2Cl3I |
| Smiles | Clc(cc1Cl)cc(Cl)c1N/N=C\c(cccc1)c1I |
| InChI | InChI=1S/C13H8Cl3IN2/c14-9-5-10(15)13(11(16)6-9)19-18-7-8-3-1-2-4-12(8)17/h1-7,19H |
| InChIK | OFUFXVWSMZMEDJ-UHFFFAOYSA-N |
| TotalMolweight | 425.48 |
| Molweight | 425.48 |
| MonoisotopicMass | 423.879777 |
| CLogP | 7.096 |
| CLogS | -6.373 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 241.78 |
| Relative PSA | 0.095004 |
| PolarSurfaceArea | 24.39 |
| Druglikeness | 2.9193 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2,4,6-trichloro-N-[(Z)-(2-iodophenyl)methylideneamino]aniline | 2 - 2,4,6-trichloro-N-[(Z)-(2-iodophenyl)methylideneamino]aniline