| MolName | [4-[(Z)-[[2-(4-bromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate |
| MolecularFormula | C22H16N2O4BrI |
| Smiles | O=C(COc(cc1)ccc1Br)N/N=C\c(cc1)ccc1OC(c(cccc1)c1I)=O |
| InChI | InChI=1S/C22H16BrIN2O4/c23-16-7-11-17(12-8-16)29-14-21(27)26-25-13-15-5-9-18(10-6-15)30-22(28)19-3-1-2-4-20(19)24/h1-13H,14H2,(H,26,27) |
| InChIK | OFZXXXDBDZJFIY-UHFFFAOYSA-N |
| TotalMolweight | 579.183 |
| Molweight | 579.183 |
| MonoisotopicMass | 577.933817 |
| CLogP | 5.3693 |
| CLogS | -6.821 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 343.17 |
| Relative PSA | 0.20121 |
| PolarSurfaceArea | 76.99 |
| Druglikeness | 2.6318 |
| Mutagenic | low |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-(4-bromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate | 2 - [4-[(Z)-[[2-(4-bromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate