| MolName | N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(Z)-(6-chloro-4-oxochromen-3-yl)methylideneamino]oxamide |
| MolecularFormula | C25H16N4O5BrCl |
| Smiles | O=C(C(N/N=C\C1=COc(ccc(Cl)c2)c2C1=O)=O)Nc(cccc1)c1C(Nc(cc1)ccc1Br)=O |
| InChI | InChI=1S/C25H16BrClN4O5/c26-15-5-8-17(9-6-15)29-23(33)18-3-1-2-4-20(18)30-24(34)25(35)31-28-12-14-13-36-21-10-7-16(27)11-19(21)22(14)32/h1-13H,(H,29,33)(H,30,34)(H,31,35) |
| InChIK | OGKDWQDCSYDXAQ-UHFFFAOYSA-N |
| TotalMolweight | 567.782 |
| Molweight | 567.782 |
| MonoisotopicMass | 565.999259 |
| CLogP | 3.74 |
| CLogS | -7.157 |
| H Acceptors | 9 |
| H Donors | 3 |
| TotalSurfaceArea | 378.18 |
| Relative PSA | 0.28571 |
| PolarSurfaceArea | 125.96 |
| Druglikeness | 2.4628 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | twice activated DB; acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(Z)-(6-chloro-4-oxochromen-3-yl)methylideneamino]oxamide | 2 - N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(Z)-(6-chloro-4-oxochromen-3-yl)methylideneamino]oxamide