| MolName | N-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]pyrazine-2-carboxamide |
| MolecularFormula | C21H16N6O |
| Smiles | O=C(c1nccnc1)N/N=C\c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H16N6O/c28-21(19-14-22-11-12-23-19)25-24-13-17-15-27(18-9-5-2-6-10-18)26-20(17)16-7-3-1-4-8-16/h1-15H,(H,25,28) |
| InChIK | OGYQTQRNOFJUOH-UHFFFAOYSA-N |
| TotalMolweight | 368.399 |
| Molweight | 368.399 |
| MonoisotopicMass | 368.138559 |
| CLogP | 2.1728 |
| CLogS | -3.668 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 291.99 |
| Relative PSA | 0.25956 |
| PolarSurfaceArea | 85.06 |
| Druglikeness | 5.9121 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53571 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]pyrazine-2-carboxamide | 2 - N-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]pyrazine-2-carboxamide