| MolName | (Z)-1-(furan-2-yl)-N-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]methanimine |
| MolecularFormula | C20H22N3O |
| Smiles | C(c1cccc2ccccc12)[NH+](CC1)CCN1/N=C\c1ccco1 |
| InChI | InChI=1S/C20H21N3O/c1-2-9-20-17(5-1)6-3-7-18(20)16-22-10-12-23(13-11-22)21-15-19-8-4-14-24-19/h1-9,14-15H,10-13,16H2/p+1 |
| InChIK | OHOZWMLATLVAIH-UHFFFAOYSA-O |
| TotalMolweight | 320.415 |
| Molweight | 320.415 |
| MonoisotopicMass | 320.176287 |
| CLogP | 1.2924 |
| CLogS | -3.944 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 272.01 |
| Relative PSA | 0.17191 |
| PolarSurfaceArea | 33.18 |
| Druglikeness | 3.4032 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(furan-2-yl)-N-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]methanimine | 2 - (Z)-1-(furan-2-yl)-N-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]methanimine