| MolName | 2-N-[(Z)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C28H28N7OCl |
| Smiles | Clc1c(COc2ccc(/C=N\Nc3nc(N4CCCCC4)nc(Nc4ccccc4)n3)cc2)cccc1 |
| InChI | InChI=1S/C28H28ClN7O/c29-25-12-6-5-9-22(25)20-37-24-15-13-21(14-16-24)19-30-35-27-32-26(31-23-10-3-1-4-11-23)33-28(34-27)36-17-7-2-8-18-36/h1,3-6,9-16,19H,2,7-8,17-18,20H2,(H2,31,32,33,34,35) |
| InChIK | OHQUNAZIQVNCRM-UHFFFAOYSA-N |
| TotalMolweight | 514.031 |
| Molweight | 514.031 |
| MonoisotopicMass | 513.204385 |
| CLogP | 8.58 |
| CLogS | -7.982 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 401.28 |
| Relative PSA | 0.20158 |
| PolarSurfaceArea | 87.56 |
| Druglikeness | 2.375 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.56757 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 7 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine