| MolName | [4-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate |
| MolecularFormula | C27H29N9O6 |
| Smiles | [O-][N+](c1cc(C(Oc2ccc(/C=N\Nc3nc(N4CCCCC4)nc(N4CCCCC4)n3)cc2)=O)cc([N+]([O-])=O)c1)=O |
| InChI | InChI=1S/C27H29N9O6/c37-24(20-15-21(35(38)39)17-22(16-20)36(40)41)42-23-9-7-19(8-10-23)18-28-32-25-29-26(33-11-3-1-4-12-33)31-27(30-25)34-13-5-2-6-14-34/h7-10,15-18H,1-6,11-14H2,(H,29,30,31,32) |
| InChIK | OIYPSFOTBSGZBF-UHFFFAOYSA-N |
| TotalMolweight | 575.584 |
| Molweight | 575.584 |
| MonoisotopicMass | 575.224081 |
| CLogP | 5.0046 |
| CLogS | -7.709 |
| H Acceptors | 15 |
| H Donors | 1 |
| TotalSurfaceArea | 431.57 |
| Relative PSA | 0.34029 |
| PolarSurfaceArea | 187.48 |
| Druglikeness | -2.9029 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 42 |
| NonCHAtoms | 15 |
| Electronegative Atoms | 15 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 13 |
| Symmetricatoms | 17 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate | 2 - [4-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate