| MolName | 2-[(2Z)-2-[[3-(difluoromethoxy)phenyl]methylidene]hydrazinyl]ethanol |
| MolecularFormula | C10H12N2O2F2 |
| Smiles | OCCN/N=C\c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C10H12F2N2O2/c11-10(12)16-9-3-1-2-8(6-9)7-14-13-4-5-15/h1-3,6-7,10,13,15H,4-5H2 |
| InChIK | OIZZPUBSJXMKLM-UHFFFAOYSA-N |
| TotalMolweight | 230.213 |
| Molweight | 230.213 |
| MonoisotopicMass | 230.086684 |
| CLogP | 1.3501 |
| CLogS | -2.684 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 178.55 |
| Relative PSA | 0.25802 |
| PolarSurfaceArea | 53.85 |
| Druglikeness | -0.29728 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 6 |
| Symmetricatoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(2Z)-2-[[3-(difluoromethoxy)phenyl]methylidene]hydrazinyl]ethanol | 2 - 2-[(2Z)-2-[[3-(difluoromethoxy)phenyl]methylidene]hydrazinyl]ethanol