| MolName | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-amine |
| MolecularFormula | C17H11N5Cl2 |
| Smiles | Clc1cc(Cl)c(/C=N\Nc2ncnc3c2[nH]c2c3cccc2)cc1 |
| InChI | InChI=1S/C17H11Cl2N5/c18-11-6-5-10(13(19)7-11)8-22-24-17-16-15(20-9-21-17)12-3-1-2-4-14(12)23-16/h1-9,23H,(H,20,21,24) |
| InChIK | OJKYKQQWOJRAIS-UHFFFAOYSA-N |
| TotalMolweight | 356.215 |
| Molweight | 356.215 |
| MonoisotopicMass | 355.039149 |
| CLogP | 6.3199 |
| CLogS | -6.063 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 256.37 |
| Relative PSA | 0.22975 |
| PolarSurfaceArea | 65.96 |
| Druglikeness | 2.5311 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-amine | 2 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-amine