| MolName | (Z)-1-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C20H14N4OI2 |
| Smiles | Ic1cc(/C=N\n2cnnc2)cc(I)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C20H14I2N4O/c21-18-8-14(10-25-26-12-23-24-13-26)9-19(22)20(18)27-11-16-6-3-5-15-4-1-2-7-17(15)16/h1-10,12-13H,11H2 |
| InChIK | OJOVTJVBTYPHKF-UHFFFAOYSA-N |
| TotalMolweight | 580.158 |
| Molweight | 580.158 |
| MonoisotopicMass | 579.925707 |
| CLogP | 4.645 |
| CLogS | -9.289 |
| H Acceptors | 5 |
| TotalSurfaceArea | 315.18 |
| Relative PSA | 0.15965 |
| PolarSurfaceArea | 52.3 |
| Druglikeness | 3.5575 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.59259 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 5 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine