| MolName | N-[(Z)-cyclohexylmethylideneamino]naphthalene-1-carboxamide |
| MolecularFormula | C18H20N2O |
| Smiles | O=C(c1cccc2ccccc12)N/N=C\C1CCCCC1 |
| InChI | InChI=1S/C18H20N2O/c21-18(20-19-13-14-7-2-1-3-8-14)17-12-6-10-15-9-4-5-11-16(15)17/h4-6,9-14H,1-3,7-8H2,(H,20,21) |
| InChIK | OKNRCECTUJIPFW-UHFFFAOYSA-N |
| TotalMolweight | 280.37 |
| Molweight | 280.37 |
| MonoisotopicMass | 280.157563 |
| CLogP | 3.9854 |
| CLogS | -5.405 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 229.63 |
| Relative PSA | 0.15682 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | -0.46332 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61905 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-cyclohexylmethylideneamino]naphthalene-1-carboxamide | 2 - N-[(Z)-cyclohexylmethylideneamino]naphthalene-1-carboxamide