| MolName | N,N'-bis[(Z)-anthracen-9-ylmethylideneamino]oxamide |
| MolecularFormula | C32H22N4O2 |
| Smiles | O=C(C(N/N=C\c1c(cccc2)c2cc2ccccc12)=O)N/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C32H22N4O2/c37-31(35-33-19-29-25-13-5-1-9-21(25)17-22-10-2-6-14-26(22)29)32(38)36-34-20-30-27-15-7-3-11-23(27)18-24-12-4-8-16-28(24)30/h1-20H,(H,35,37)(H,36,38) |
| InChIK | OKYILZMQCXOBII-UHFFFAOYSA-N |
| TotalMolweight | 494.553 |
| Molweight | 494.553 |
| MonoisotopicMass | 494.174276 |
| CLogP | 7.316 |
| CLogS | -10.542 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 379.36 |
| Relative PSA | 0.18985 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | 3.3385 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.47368 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 28 |
| Symmetricatoms | 25 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-anthracen-9-ylmethylideneamino]oxamide | 2 - N,N'-bis[(Z)-anthracen-9-ylmethylideneamino]oxamide