| MolName | N-[(Z)-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine |
| MolecularFormula | C28H32N6OClF |
| Smiles | Fc1ccc(COc(cc2)c(/C=N\Nc3nc(N4CCCCC4)nc(N4CCCCC4)c3)cc2Cl)cc1 |
| InChI | InChI=1S/C28H32ClFN6O/c29-23-9-12-25(37-20-21-7-10-24(30)11-8-21)22(17-23)19-31-34-26-18-27(35-13-3-1-4-14-35)33-28(32-26)36-15-5-2-6-16-36/h7-12,17-19H,1-6,13-16,20H2,(H,32,33,34) |
| InChIK | OKYVIQKQLNEVFZ-UHFFFAOYSA-N |
| TotalMolweight | 523.054 |
| Molweight | 523.054 |
| MonoisotopicMass | 522.231014 |
| CLogP | 8.0709 |
| CLogS | -7.841 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 403.25 |
| Relative PSA | 0.15378 |
| PolarSurfaceArea | 65.88 |
| Druglikeness | 0.90847 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51351 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 12 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine | 2 - N-[(Z)-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine