| MolName | N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1,3-benzoxazol-2-amine |
| MolecularFormula | C16H12N4O3 |
| Smiles | [O-][N+](c1c(/C=C/C=N\Nc2nc(cccc3)c3o2)cccc1)=O |
| InChI | InChI=1S/C16H12N4O3/c21-20(22)14-9-3-1-6-12(14)7-5-11-17-19-16-18-13-8-2-4-10-15(13)23-16/h1-11H,(H,18,19) |
| InChIK | OLCSQJUQATXGKX-UHFFFAOYSA-N |
| TotalMolweight | 308.296 |
| Molweight | 308.296 |
| MonoisotopicMass | 308.090941 |
| CLogP | 4.1485 |
| CLogS | -5.017 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 242.46 |
| Relative PSA | 0.32364 |
| PolarSurfaceArea | 96.24 |
| Druglikeness | -3.0904 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.6087 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1,3-benzoxazol-2-amine | 2 - N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1,3-benzoxazol-2-amine