| MolName | 2-N,4-N-bis[(Z)-(3-iodophenyl)methylideneamino]-6-N-naphthalen-1-yl-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C27H20N8I2 |
| Smiles | Ic1cccc(/C=N\Nc2nc(Nc3cccc4ccccc34)nc(N/N=C\c3cccc(I)c3)n2)c1 |
| InChI | InChI=1S/C27H20I2N8/c28-21-10-3-6-18(14-21)16-30-36-26-33-25(32-24-13-5-9-20-8-1-2-12-23(20)24)34-27(35-26)37-31-17-19-7-4-11-22(29)15-19/h1-17H,(H3,32,33,34,35,36,37) |
| InChIK | OLGIOVUHMJBVID-UHFFFAOYSA-N |
| TotalMolweight | 710.312 |
| Molweight | 710.312 |
| MonoisotopicMass | 709.990038 |
| CLogP | 11.043 |
| CLogS | -10.084 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 419.88 |
| Relative PSA | 0.21509 |
| PolarSurfaceArea | 99.48 |
| Druglikeness | 3.0801 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.45946 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N,4-N-bis[(Z)-(3-iodophenyl)methylideneamino]-6-N-naphthalen-1-yl-1,3,5-triazine-2,4,6-triamine | 2 - 2-N,4-N-bis[(Z)-(3-iodophenyl)methylideneamino]-6-N-naphthalen-1-yl-1,3,5-triazine-2,4,6-triamine