| MolName | N-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| MolecularFormula | C22H23N7O3Cl2 |
| Smiles | Clc(ccc(-c1ccc(/C=N\Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)o1)c1)c1Cl |
| InChI | InChI=1S/C22H23Cl2N7O3/c23-17-3-1-15(13-18(17)24)19-4-2-16(34-19)14-25-29-20-26-21(30-5-9-32-10-6-30)28-22(27-20)31-7-11-33-12-8-31/h1-4,13-14H,5-12H2,(H,26,27,28,29) |
| InChIK | OLZHLCRPFPRWMH-UHFFFAOYSA-N |
| TotalMolweight | 504.377 |
| Molweight | 504.377 |
| MonoisotopicMass | 503.123942 |
| CLogP | 5.7514 |
| CLogS | -6.473 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 369.49 |
| Relative PSA | 0.26277 |
| PolarSurfaceArea | 101.14 |
| Druglikeness | 5.1983 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 10 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine | 2 - N-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine