| MolName | 2-[4-[(Z)-[[2-(4-chloro-2-cyclohexylphenoxy)acetyl]hydrazinylidene]methyl]-3-phenylpyrazol-1-yl]acetamide |
| MolecularFormula | C26H28N5O3Cl |
| Smiles | NC(Cn(cc1/C=N\NC(COc(cc2)c(C3CCCCC3)cc2Cl)=O)nc1-c1ccccc1)=O |
| InChI | InChI=1S/C26H28ClN5O3/c27-21-11-12-23(22(13-21)18-7-3-1-4-8-18)35-17-25(34)30-29-14-20-15-32(16-24(28)33)31-26(20)19-9-5-2-6-10-19/h2,5-6,9-15,18H,1,3-4,7-8,16-17H2,(H2,28,33)(H,30,34) |
| InChIK | OMASRBKLFIKABG-UHFFFAOYSA-N |
| TotalMolweight | 493.993 |
| Molweight | 493.993 |
| MonoisotopicMass | 493.188067 |
| CLogP | 3.9137 |
| CLogS | -6.105 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 381.72 |
| Relative PSA | 0.24143 |
| PolarSurfaceArea | 111.6 |
| Druglikeness | 2.2382 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51429 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 9 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-[(Z)-[[2-(4-chloro-2-cyclohexylphenoxy)acetyl]hydrazinylidene]methyl]-3-phenylpyrazol-1-yl]acetamide | 2 - 2-[4-[(Z)-[[2-(4-chloro-2-cyclohexylphenoxy)acetyl]hydrazinylidene]methyl]-3-phenylpyrazol-1-yl]acetamide