| MolName | N-[(Z)-anthracen-9-ylmethylideneamino]-2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]acetamide |
| MolecularFormula | C30H21N3O3ClF3S |
| Smiles | O=C(CN(c(cc1)cc(C(F)(F)F)c1Cl)S(c1ccccc1)(=O)=O)N/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C30H21ClF3N3O3S/c31-28-15-14-22(17-27(28)30(32,33)34)37(41(39,40)23-10-2-1-3-11-23)19-29(38)36-35-18-26-24-12-6-4-8-20(24)16-21-9-5-7-13-25(21)26/h1-18H,19H2,(H,36,38) |
| InChIK | OMEWHQJZBNRZIO-UHFFFAOYSA-N |
| TotalMolweight | 596.028 |
| Molweight | 596.028 |
| MonoisotopicMass | 595.094423 |
| CLogP | 6.8939 |
| CLogS | -9.652 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 413.47 |
| Relative PSA | 0.1648 |
| PolarSurfaceArea | 87.22 |
| Druglikeness | -10.864 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.39024 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 3 |
| Symmetricatoms | 11 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-anthracen-9-ylmethylideneamino]-2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]acetamide | 2 - N-[(Z)-anthracen-9-ylmethylideneamino]-2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]acetamide