| MolName | [4-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
| MolecularFormula | C26H19N3O6 |
| Smiles | [O-][N+](c(cccc1)c1OCC(N/N=C\c(cc1)ccc1OC(c1cccc2ccccc12)=O)=O)=O |
| InChI | InChI=1S/C26H19N3O6/c30-25(17-34-24-11-4-3-10-23(24)29(32)33)28-27-16-18-12-14-20(15-13-18)35-26(31)22-9-5-7-19-6-1-2-8-21(19)22/h1-16H,17H2,(H,28,30) |
| InChIK | OMOVGAGWUJULRC-UHFFFAOYSA-N |
| TotalMolweight | 469.452 |
| Molweight | 469.452 |
| MonoisotopicMass | 469.127387 |
| CLogP | 4.4798 |
| CLogS | -7.037 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 356.53 |
| Relative PSA | 0.27899 |
| PolarSurfaceArea | 122.81 |
| Druglikeness | -1.0859 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate | 2 - [4-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate