| MolName | [2-[(Z)-(1,3-dihydro-2-benzofuran-5-carbonylhydrazinylidene)methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| MolecularFormula | C24H18N2O6 |
| Smiles | O=C(c1cc(COC2)c2cc1)N/N=C\c(cccc1)c1OC(c(cc1)cc2c1OCO2)=O |
| InChI | InChI=1S/C24H18N2O6/c27-23(15-5-6-18-12-29-13-19(18)9-15)26-25-11-17-3-1-2-4-20(17)32-24(28)16-7-8-21-22(10-16)31-14-30-21/h1-11H,12-14H2,(H,26,27) |
| InChIK | OMSQHEMOPLYEMZ-UHFFFAOYSA-N |
| TotalMolweight | 430.415 |
| Molweight | 430.415 |
| MonoisotopicMass | 430.116488 |
| CLogP | 3.6273 |
| CLogS | -6.151 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 318.78 |
| Relative PSA | 0.27935 |
| PolarSurfaceArea | 95.45 |
| Druglikeness | 2.1432 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-(1,3-dihydro-2-benzofuran-5-carbonylhydrazinylidene)methyl]phenyl] 1,3-benzodioxole-5-carboxylate | 2 - [2-[(Z)-(1,3-dihydro-2-benzofuran-5-carbonylhydrazinylidene)methyl]phenyl] 1,3-benzodioxole-5-carboxylate