| MolName | N,N'-bis[(Z)-(5-nitrofuran-2-yl)methylideneamino]decanediamide |
| MolecularFormula | C20H24N6O8 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(CCCCCCCCC(N/N=C\c2ccc([N+]([O-])=O)o2)=O)=O)o1)=O |
| InChI | InChI=1S/C20H24N6O8/c27-17(23-21-13-15-9-11-19(33-15)25(29)30)7-5-3-1-2-4-6-8-18(28)24-22-14-16-10-12-20(34-16)26(31)32/h9-14H,1-8H2,(H,23,27)(H,24,28) |
| InChIK | ONAUKRHXWZFMGH-UHFFFAOYSA-N |
| TotalMolweight | 476.445 |
| Molweight | 476.445 |
| MonoisotopicMass | 476.165564 |
| CLogP | 3.4106 |
| CLogS | -7.612 |
| H Acceptors | 14 |
| H Donors | 2 |
| TotalSurfaceArea | 377.76 |
| Relative PSA | 0.42641 |
| PolarSurfaceArea | 200.84 |
| Druglikeness | -5.3919 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.76471 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 15 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 10 |
| Symmetricatoms | 17 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(5-nitrofuran-2-yl)methylideneamino]decanediamide | 2 - N,N'-bis[(Z)-(5-nitrofuran-2-yl)methylideneamino]decanediamide