| MolName | N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| MolecularFormula | C19H22N7O4Cl |
| Smiles | Clc1c(/C=N\Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc2OCOc2c1 |
| InChI | InChI=1S/C19H22ClN7O4/c20-14-10-16-15(30-12-31-16)9-13(14)11-21-25-17-22-18(26-1-5-28-6-2-26)24-19(23-17)27-3-7-29-8-4-27/h9-11H,1-8,12H2,(H,22,23,24,25) |
| InChIK | ONBHWZAKYVLOLK-UHFFFAOYSA-N |
| TotalMolweight | 447.882 |
| Molweight | 447.882 |
| MonoisotopicMass | 447.14218 |
| CLogP | 4.3179 |
| CLogS | -4.988 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 324.88 |
| Relative PSA | 0.31698 |
| PolarSurfaceArea | 106.46 |
| Druglikeness | 3.2375 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48387 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 13 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine | 2 - N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine