| MolName | N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide |
| MolecularFormula | C20H15N4OF3 |
| Smiles | O=C(c1c(CCc2c-3cccc2)c3n[nH]1)N/N=C\c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H15F3N4O/c21-20(22,23)14-8-5-12(6-9-14)11-24-27-19(28)18-16-10-7-13-3-1-2-4-15(13)17(16)25-26-18/h1-6,8-9,11H,7,10H2,(H,25,26)(H,27,28) |
| InChIK | ONWXTVAKMDFXJW-UHFFFAOYSA-N |
| TotalMolweight | 384.36 |
| Molweight | 384.36 |
| MonoisotopicMass | 384.119795 |
| CLogP | 4.2205 |
| CLogS | -5.426 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 278.56 |
| Relative PSA | 0.21888 |
| PolarSurfaceArea | 70.14 |
| Druglikeness | -2.4556 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide | 2 - N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide