| MolName | 5-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyltriazole-4-carbonyl]hydrazinylidene]methyl]thiophene-2-carboxylic acid |
| MolecularFormula | C17H12N8O4S |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2ccc(C(O)=O)s2)=O)c1-c1ccccc1 |
| InChI | InChI=1S/C17H12N8O4S/c18-14-15(23-29-22-14)25-13(9-4-2-1-3-5-9)12(20-24-25)16(26)21-19-8-10-6-7-11(30-10)17(27)28/h1-8H,(H2,18,22)(H,21,26)(H,27,28) |
| InChIK | ONXMDGKWELRPRG-UHFFFAOYSA-N |
| TotalMolweight | 424.4 |
| Molweight | 424.4 |
| MonoisotopicMass | 424.070222 |
| CLogP | 2.8795 |
| CLogS | -3.339 |
| H Acceptors | 12 |
| H Donors | 3 |
| TotalSurfaceArea | 309 |
| Relative PSA | 0.52634 |
| PolarSurfaceArea | 202.65 |
| Druglikeness | 3.214 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 5 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyltriazole-4-carbonyl]hydrazinylidene]methyl]thiophene-2-carboxylic acid | 2 - 5-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyltriazole-4-carbonyl]hydrazinylidene]methyl]thiophene-2-carboxylic acid