| MolName | 3-chloro-N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-1-benzothiophene-2-carboxamide |
| MolecularFormula | C30H20N3OClS |
| Smiles | O=C(c(sc1c2cccc1)c2Cl)N/N=C\c(c1c2cccc1)c(-c1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C30H20ClN3OS/c31-27-23-16-8-10-18-26(23)36-29(27)30(35)33-32-19-24-22-15-7-9-17-25(22)34(21-13-5-2-6-14-21)28(24)20-11-3-1-4-12-20/h1-19H,(H,33,35) |
| InChIK | OOANHBXARIXDAX-UHFFFAOYSA-N |
| TotalMolweight | 506.028 |
| Molweight | 506.028 |
| MonoisotopicMass | 505.101559 |
| CLogP | 7.9808 |
| CLogS | -11.398 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 376.27 |
| Relative PSA | 0.16807 |
| PolarSurfaceArea | 74.63 |
| Druglikeness | 6.4575 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; 3-halo-enone |
| Shape Index | 0.44444 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 30 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-chloro-N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-1-benzothiophene-2-carboxamide | 2 - 3-chloro-N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-1-benzothiophene-2-carboxamide