| MolName | benzyl N-[2-[(2Z)-2-[[1-[(4-fluorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-2-oxoethyl]carbamate |
| MolecularFormula | C26H23N4O3F |
| Smiles | O=C(CNC(OCc1ccccc1)=O)N/N=C\c1cn(Cc(cc2)ccc2F)c2c1cccc2 |
| InChI | InChI=1S/C26H23FN4O3/c27-22-12-10-19(11-13-22)16-31-17-21(23-8-4-5-9-24(23)31)14-29-30-25(32)15-28-26(33)34-18-20-6-2-1-3-7-20/h1-14,17H,15-16,18H2,(H,28,33)(H,30,32) |
| InChIK | OOJFJGKTVZFDDG-UHFFFAOYSA-N |
| TotalMolweight | 458.492 |
| Molweight | 458.492 |
| MonoisotopicMass | 458.175419 |
| CLogP | 4.0933 |
| CLogS | -5.248 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 357.39 |
| Relative PSA | 0.21651 |
| PolarSurfaceArea | 84.72 |
| Druglikeness | -8.6273 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - benzyl N-[2-[(2Z)-2-[[1-[(4-fluorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-2-oxoethyl]carbamate | 2 - benzyl N-[2-[(2Z)-2-[[1-[(4-fluorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-2-oxoethyl]carbamate