| MolName | N,N'-bis[(Z)-(3-bromophenyl)methylideneamino]hexanediamide |
| MolecularFormula | C20H20N4O2Br2 |
| Smiles | O=C(CCCCC(N/N=C\c1cccc(Br)c1)=O)N/N=C\c1cc(Br)ccc1 |
| InChI | InChI=1S/C20H20Br2N4O2/c21-17-7-3-5-15(11-17)13-23-25-19(27)9-1-2-10-20(28)26-24-14-16-6-4-8-18(22)12-16/h3-8,11-14H,1-2,9-10H2,(H,25,27)(H,26,28) |
| InChIK | OOKBKKVCGHXLON-UHFFFAOYSA-N |
| TotalMolweight | 508.213 |
| Molweight | 508.213 |
| MonoisotopicMass | 505.995298 |
| CLogP | 5.8064 |
| CLogS | -6.866 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 333.26 |
| Relative PSA | 0.21611 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | -5.9195 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 9 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 14 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(3-bromophenyl)methylideneamino]hexanediamide | 2 - N,N'-bis[(Z)-(3-bromophenyl)methylideneamino]hexanediamide