| MolName | 4-N-(4-fluorophenyl)-6-morpholin-4-yl-2-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C21H19N7OF4 |
| Smiles | FC(c1c(/C=N\Nc2nc(Nc(cc3)ccc3F)nc(N3CCOCC3)n2)cccc1)(F)F |
| InChI | InChI=1S/C21H19F4N7O/c22-15-5-7-16(8-6-15)27-18-28-19(30-20(29-18)32-9-11-33-12-10-32)31-26-13-14-3-1-2-4-17(14)21(23,24)25/h1-8,13H,9-12H2,(H2,27,28,29,30,31) |
| InChIK | OOWGKJHNBUYTEW-UHFFFAOYSA-N |
| TotalMolweight | 461.422 |
| Molweight | 461.422 |
| MonoisotopicMass | 461.15872 |
| CLogP | 6.411 |
| CLogS | -6.108 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 334.39 |
| Relative PSA | 0.2419 |
| PolarSurfaceArea | 87.56 |
| Druglikeness | -3.7641 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48485 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-N-(4-fluorophenyl)-6-morpholin-4-yl-2-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine | 2 - 4-N-(4-fluorophenyl)-6-morpholin-4-yl-2-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine