| MolName | N-[(Z)-furan-2-ylmethylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| MolecularFormula | C14H12N2O4 |
| Smiles | O=C(C1Oc(cccc2)c2OC1)N/N=C\c1ccco1 |
| InChI | InChI=1S/C14H12N2O4/c17-14(16-15-8-10-4-3-7-18-10)13-9-19-11-5-1-2-6-12(11)20-13/h1-8,13H,9H2,(H,16,17)/t13-/m0/s1 |
| InChIK | OPFBQGORAOGBAG-ZDUSSCGKSA-N |
| TotalMolweight | 272.259 |
| Molweight | 272.259 |
| MonoisotopicMass | 272.079708 |
| CLogP | 1.9324 |
| CLogS | -3.425 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 209.44 |
| Relative PSA | 0.3348 |
| PolarSurfaceArea | 73.06 |
| Druglikeness | 4.8606 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| StereoCenters | 1 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| StereoCon | racemate |
Click to Load Molecule:
1 - N-[(Z)-furan-2-ylmethylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide | 2 - N-[(Z)-furan-2-ylmethylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide