| MolName | 4-N,5-N,3-triphenyl-2-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1,3-thiazolidine-2,4,5-triimine |
| MolecularFormula | C30H23N5S |
| Smiles | C(/C=N\N=C(/N(/C1=N/c2ccccc2)c2ccccc2)\S/C1=N\c1ccccc1)=C/c1ccccc1 |
| InChI | InChI=1S/C30H23N5S/c1-5-14-24(15-6-1)16-13-23-31-34-30-35(27-21-11-4-12-22-27)28(32-25-17-7-2-8-18-25)29(36-30)33-26-19-9-3-10-20-26/h1-23H |
| InChIK | OPKGOUHTZCFBTC-UHFFFAOYSA-N |
| TotalMolweight | 485.614 |
| Molweight | 485.614 |
| MonoisotopicMass | 485.167415 |
| CLogP | 6.5572 |
| CLogS | -6.872 |
| H Acceptors | 5 |
| TotalSurfaceArea | 387 |
| Relative PSA | 0.17333 |
| PolarSurfaceArea | 77.98 |
| Druglikeness | 3.962 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.47222 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 1 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - 4-N,5-N,3-triphenyl-2-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1,3-thiazolidine-2,4,5-triimine | 2 - 4-N,5-N,3-triphenyl-2-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1,3-thiazolidine-2,4,5-triimine