| MolName | 2-amino-1-[(Z)-benzylideneamino]-N-[2-(cyclohexen-1-yl)ethyl]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| MolecularFormula | C26H26N6O |
| Smiles | Nc1c(C(NCCC2=CCCCC2)=O)c2nc3ccccc3nc2n1/N=C\c1ccccc1 |
| InChI | InChI=1S/C26H26N6O/c27-24-22(26(33)28-16-15-18-9-3-1-4-10-18)23-25(31-21-14-8-7-13-20(21)30-23)32(24)29-17-19-11-5-2-6-12-19/h2,5-9,11-14,17H,1,3-4,10,15-16,27H2,(H,28,33) |
| InChIK | OPNFNWOOJDYCHT-UHFFFAOYSA-N |
| TotalMolweight | 438.533 |
| Molweight | 438.533 |
| MonoisotopicMass | 438.216809 |
| CLogP | 4.554 |
| CLogS | -8.669 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 345.2 |
| Relative PSA | 0.23201 |
| PolarSurfaceArea | 98.19 |
| Druglikeness | 0.0040479 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-amino-1-[(Z)-benzylideneamino]-N-[2-(cyclohexen-1-yl)ethyl]pyrrolo[3,2-b]quinoxaline-3-carboxamide | 2 - 2-amino-1-[(Z)-benzylideneamino]-N-[2-(cyclohexen-1-yl)ethyl]pyrrolo[3,2-b]quinoxaline-3-carboxamide