| MolName | 3-amino-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-6-(4-chlorophenyl)-4-phenylfuro[2,3-b]pyridine-2-carboxamide |
| MolecularFormula | C28H19N4O4Cl |
| Smiles | Nc1c(C(N/N=C\c(cc2)cc3c2OCO3)=O)oc2c1c(-c1ccccc1)cc(-c(cc1)ccc1Cl)n2 |
| InChI | InChI=1S/C28H19ClN4O4/c29-19-9-7-18(8-10-19)21-13-20(17-4-2-1-3-5-17)24-25(30)26(37-28(24)32-21)27(34)33-31-14-16-6-11-22-23(12-16)36-15-35-22/h1-14H,15,30H2,(H,33,34) |
| InChIK | OPVQIYNRBUBALT-UHFFFAOYSA-N |
| TotalMolweight | 510.936 |
| Molweight | 510.936 |
| MonoisotopicMass | 510.109483 |
| CLogP | 6.4387 |
| CLogS | -10.341 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 373.76 |
| Relative PSA | 0.25781 |
| PolarSurfaceArea | 111.97 |
| Druglikeness | 4.4716 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51351 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-amino-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-6-(4-chlorophenyl)-4-phenylfuro[2,3-b]pyridine-2-carboxamide | 2 - 3-amino-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-6-(4-chlorophenyl)-4-phenylfuro[2,3-b]pyridine-2-carboxamide