| MolName | [3-[(Z)-(2,3-dihydro-1,4-benzodioxine-6-carbonylhydrazinylidene)methyl]phenyl] 2-chlorobenzoate |
| MolecularFormula | C23H17N2O5Cl |
| Smiles | O=C(c(cc1)cc2c1OCCO2)N/N=C\c1cccc(OC(c(cccc2)c2Cl)=O)c1 |
| InChI | InChI=1S/C23H17ClN2O5/c24-19-7-2-1-6-18(19)23(28)31-17-5-3-4-15(12-17)14-25-26-22(27)16-8-9-20-21(13-16)30-11-10-29-20/h1-9,12-14H,10-11H2,(H,26,27) |
| InChIK | OPZFBMPSCVBRQU-UHFFFAOYSA-N |
| TotalMolweight | 436.85 |
| Molweight | 436.85 |
| MonoisotopicMass | 436.0826 |
| CLogP | 5.2169 |
| CLogS | -6.109 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 323.94 |
| Relative PSA | 0.24403 |
| PolarSurfaceArea | 86.22 |
| Druglikeness | -3.0419 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6129 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - [3-[(Z)-(2,3-dihydro-1,4-benzodioxine-6-carbonylhydrazinylidene)methyl]phenyl] 2-chlorobenzoate | 2 - [3-[(Z)-(2,3-dihydro-1,4-benzodioxine-6-carbonylhydrazinylidene)methyl]phenyl] 2-chlorobenzoate