| MolName | [4-[(Z)-[[4-(benzenesulfonamido)benzoyl]hydrazinylidene]methyl]-3-benzoyloxyphenyl] benzoate |
| MolecularFormula | C34H25N3O7S |
| Smiles | O=C(c(cc1)ccc1NS(c1ccccc1)(=O)=O)N/N=C\c(ccc(OC(c1ccccc1)=O)c1)c1OC(c1ccccc1)=O |
| InChI | InChI=1S/C34H25N3O7S/c38-32(24-16-19-28(20-17-24)37-45(41,42)30-14-8-3-9-15-30)36-35-23-27-18-21-29(43-33(39)25-10-4-1-5-11-25)22-31(27)44-34(40)26-12-6-2-7-13-26/h1-23,37H,(H,36,38) |
| InChIK | OQGGMYXANBLYRH-UHFFFAOYSA-N |
| TotalMolweight | 619.653 |
| Molweight | 619.653 |
| MonoisotopicMass | 619.141322 |
| CLogP | 6.3617 |
| CLogS | -7.994 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 461.81 |
| Relative PSA | 0.26446 |
| PolarSurfaceArea | 148.61 |
| Druglikeness | -2.0218 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 45 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 11 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 30 |
| Sp3Atoms | 3 |
| Symmetricatoms | 9 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[4-(benzenesulfonamido)benzoyl]hydrazinylidene]methyl]-3-benzoyloxyphenyl] benzoate | 2 - [4-[(Z)-[[4-(benzenesulfonamido)benzoyl]hydrazinylidene]methyl]-3-benzoyloxyphenyl] benzoate