| MolName | [2,4-dibromo-6-[(Z)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-fluorobenzoate |
| MolecularFormula | C23H14N3O4Br2F |
| Smiles | N#Cc(cccc1)c1OCC(N/N=C\c1cc(Br)cc(Br)c1OC(c1cc(F)ccc1)=O)=O |
| InChI | InChI=1S/C23H14Br2FN3O4/c24-17-8-16(12-28-29-21(30)13-32-20-7-2-1-4-15(20)11-27)22(19(25)10-17)33-23(31)14-5-3-6-18(26)9-14/h1-10,12H,13H2,(H,29,30) |
| InChIK | OSBALJJBBBJJDR-UHFFFAOYSA-N |
| TotalMolweight | 575.187 |
| Molweight | 575.187 |
| MonoisotopicMass | 572.933507 |
| CLogP | 5.5938 |
| CLogS | -7.726 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 363.58 |
| Relative PSA | 0.22721 |
| PolarSurfaceArea | 100.78 |
| Druglikeness | -3.4411 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - [2,4-dibromo-6-[(Z)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-fluorobenzoate | 2 - [2,4-dibromo-6-[(Z)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-fluorobenzoate